instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_16>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_16>.
**Token:** <BB_16> **SMILES:** Fc1ccc(CCN2CCNCC2)cc1 **Molecular Formula:** C12H17FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_17>.
CCOC(=O)c1nc(CN)c2n1CCCC2.Cl.Cl
What is the building block token for the following molecule?
CCOC(=O)c1nc(CN)c2n1CCCC2.Cl.Cl
<BB_17>
What is the molecular formula for <BB_17>?
The molecular formula for <BB_17> (CCOC(=O)c1nc(CN)c2n1CCCC2.Cl.Cl) is C11H19Cl2N3O2.
Describe the ring structures in building block <BB_17>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_17>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_17>.
**Token:** <BB_17> **SMILES:** CCOC(=O)c1nc(CN)c2n1CCCC2.Cl.Cl **Molecular Formula:** C11H19Cl2N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_18>.
Cc1nn(C(F)(F)F)c(C)c1C(=O)O
What is the building block token for the following molecule?
Cc1nn(C(F)(F)F)c(C)c1C(=O)O
<BB_18>
What is the molecular formula for <BB_18>?
The molecular formula for <BB_18> (Cc1nn(C(F)(F)F)c(C)c1C(=O)O) is C7H7F3N2O2.
Describe the ring structures in building block <BB_18>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_18>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_18>.
**Token:** <BB_18> **SMILES:** Cc1nn(C(F)(F)F)c(C)c1C(=O)O **Molecular Formula:** C7H7F3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_19>.
NC(=O)c1ccnnc1
What is the building block token for the following molecule?
NC(=O)c1ccnnc1
<BB_19>
What is the molecular formula for <BB_19>?
The molecular formula for <BB_19> (NC(=O)c1ccnnc1) is C5H5N3O.
Describe the ring structures in building block <BB_19>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_19>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_19>.
**Token:** <BB_19> **SMILES:** NC(=O)c1ccnnc1 **Molecular Formula:** C5H5N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_20>.
CC(=O)c1ccc(C#N)cc1
What is the building block token for the following molecule?
CC(=O)c1ccc(C#N)cc1
<BB_20>
What is the molecular formula for <BB_20>?
The molecular formula for <BB_20> (CC(=O)c1ccc(C#N)cc1) is C9H7NO.
Describe the ring structures in building block <BB_20>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_20>.
The molecule contains the following groups: Ketone, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_20>.
**Token:** <BB_20> **SMILES:** CC(=O)c1ccc(C#N)cc1 **Molecular Formula:** C9H7NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Nitrile
Provide the SMILES representation for the building block token <BB_21>.
Brc1ccc(CC2CNCCN2)cc1.Cl.Cl
What is the building block token for the following molecule?
Brc1ccc(CC2CNCCN2)cc1.Cl.Cl
<BB_21>
What is the molecular formula for <BB_21>?
The molecular formula for <BB_21> (Brc1ccc(CC2CNCCN2)cc1.Cl.Cl) is C11H17BrCl2N2.
Describe the ring structures in building block <BB_21>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_21>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_21>.
**Token:** <BB_21> **SMILES:** Brc1ccc(CC2CNCCN2)cc1.Cl.Cl **Molecular Formula:** C11H17BrCl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_22>.
C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O
What is the building block token for the following molecule?
C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O
<BB_22>
What is the molecular formula for <BB_22>?
The molecular formula for <BB_22> (C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O) is C11H9NO4.
Describe the ring structures in building block <BB_22>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_22>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_22>.
**Token:** <BB_22> **SMILES:** C[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O **Molecular Formula:** C11H9NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_23>.
Cc1cc(C)cc(C(C)(C)N)c1.Cl
What is the building block token for the following molecule?
Cc1cc(C)cc(C(C)(C)N)c1.Cl
<BB_23>
What is the molecular formula for <BB_23>?
The molecular formula for <BB_23> (Cc1cc(C)cc(C(C)(C)N)c1.Cl) is C11H18ClN.
Describe the ring structures in building block <BB_23>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_23>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_23>.
**Token:** <BB_23> **SMILES:** Cc1cc(C)cc(C(C)(C)N)c1.Cl **Molecular Formula:** C11H18ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_24>.
O=C(NO)c1cccc(C(F)(F)F)c1
What is the building block token for the following molecule?
O=C(NO)c1cccc(C(F)(F)F)c1
<BB_24>
What is the molecular formula for <BB_24>?
The molecular formula for <BB_24> (O=C(NO)c1cccc(C(F)(F)F)c1) is C8H6F3NO2.
Describe the ring structures in building block <BB_24>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_24>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_24>.
**Token:** <BB_24> **SMILES:** O=C(NO)c1cccc(C(F)(F)F)c1 **Molecular Formula:** C8H6F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_25>.
CC1(C(=O)O)COC(c2ccccc2)OC1
What is the building block token for the following molecule?
CC1(C(=O)O)COC(c2ccccc2)OC1
<BB_25>
What is the molecular formula for <BB_25>?
The molecular formula for <BB_25> (CC1(C(=O)O)COC(c2ccccc2)OC1) is C12H14O4.
Describe the ring structures in building block <BB_25>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_25>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_25>.
**Token:** <BB_25> **SMILES:** CC1(C(=O)O)COC(c2ccccc2)OC1 **Molecular Formula:** C12H14O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_26>.
Cl.Cl.NCCC[C@@H](N)CC(=O)O
What is the building block token for the following molecule?
Cl.Cl.NCCC[C@@H](N)CC(=O)O
<BB_26>
What is the molecular formula for <BB_26>?
The molecular formula for <BB_26> (Cl.Cl.NCCC[C@@H](N)CC(=O)O) is C6H16Cl2N2O2.
Describe the ring structures in building block <BB_26>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_26>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_26>.
**Token:** <BB_26> **SMILES:** Cl.Cl.NCCC[C@@H](N)CC(=O)O **Molecular Formula:** C6H16Cl2N2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_27>.
CCOC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1
What is the building block token for the following molecule?
CCOC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1
<BB_27>
What is the molecular formula for <BB_27>?
The molecular formula for <BB_27> (CCOC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1) is C9H9N5O5.
Describe the ring structures in building block <BB_27>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_27>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_27>.
**Token:** <BB_27> **SMILES:** CCOC(=O)c1nc(Cn2cc([N+](=O)[O-])cn2)no1 **Molecular Formula:** C9H9N5O5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Ester, Ether, Nitro
Provide the SMILES representation for the building block token <BB_28>.
Cn1cc(Cl)c(C(=O)NCCN)n1
What is the building block token for the following molecule?
Cn1cc(Cl)c(C(=O)NCCN)n1
<BB_28>
What is the molecular formula for <BB_28>?
The molecular formula for <BB_28> (Cn1cc(Cl)c(C(=O)NCCN)n1) is C7H11ClN4O.
Describe the ring structures in building block <BB_28>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_28>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_28>.
**Token:** <BB_28> **SMILES:** Cn1cc(Cl)c(C(=O)NCCN)n1 **Molecular Formula:** C7H11ClN4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_29>.
Cc1cccc(N(C(=O)CCl)C2C=CS(=O)(=O)C2)c1
What is the building block token for the following molecule?
Cc1cccc(N(C(=O)CCl)C2C=CS(=O)(=O)C2)c1
<BB_29>
What is the molecular formula for <BB_29>?
The molecular formula for <BB_29> (Cc1cccc(N(C(=O)CCl)C2C=CS(=O)(=O)C2)c1) is C13H14ClNO3S.
Describe the ring structures in building block <BB_29>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_29>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_29>.
**Token:** <BB_29> **SMILES:** Cc1cccc(N(C(=O)CCl)C2C=CS(=O)(=O)C2)c1 **Molecular Formula:** C13H14ClNO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_30>.
CC1(C)CC2(CCO1)CC2C(=O)O
What is the building block token for the following molecule?
CC1(C)CC2(CCO1)CC2C(=O)O
<BB_30>
What is the molecular formula for <BB_30>?
The molecular formula for <BB_30> (CC1(C)CC2(CCO1)CC2C(=O)O) is C10H16O3.
Describe the ring structures in building block <BB_30>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_30>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_30>.
**Token:** <BB_30> **SMILES:** CC1(C)CC2(CCO1)CC2C(=O)O **Molecular Formula:** C10H16O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_31>.
CC(C)[Si](C#CC=O)(C(C)C)C(C)C
What is the building block token for the following molecule?
CC(C)[Si](C#CC=O)(C(C)C)C(C)C
<BB_31>
What is the molecular formula for <BB_31>?
The molecular formula for <BB_31> (CC(C)[Si](C#CC=O)(C(C)C)C(C)C) is C12H22OSi.
Describe the ring structures in building block <BB_31>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_31>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_31>.
**Token:** <BB_31> **SMILES:** CC(C)[Si](C#CC=O)(C(C)C)C(C)C **Molecular Formula:** C12H22OSi **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_32>.
Cc1nn(CCC#N)c(C)c1Br
What is the building block token for the following molecule?
Cc1nn(CCC#N)c(C)c1Br
<BB_32>
What is the molecular formula for <BB_32>?
The molecular formula for <BB_32> (Cc1nn(CCC#N)c(C)c1Br) is C8H10BrN3.
Describe the ring structures in building block <BB_32>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_32>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_32>.
**Token:** <BB_32> **SMILES:** Cc1nn(CCC#N)c(C)c1Br **Molecular Formula:** C8H10BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_33>.
CC1(C)CC(=O)CCN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
CC1(C)CC(=O)CCN(C(=O)OC(C)(C)C)C1
<BB_33>